ChemNet > CAS > 21211-22-3 3-Chlorobenzo[b]-2-thiophenecarboxylic acid
21211-22-3 3-Chlorobenzo[b]-2-thiophenecarboxylic acid
| product Name |
3-Chlorobenzo[b]-2-thiophenecarboxylic acid |
| CAS No |
21211-22-3 |
| Synonyms |
3-Chlorobenzo[b]thiophene-2-carboxylic acid; 3-CHLORO-BENZO[B]THIOPHENE CARBOXYLIC ACID; 3-CHLORO-1-BENZOTHIOPHENE-2-CARBOXYLIC ACID; 3-CHLORO-2-BENZO[B]THIOPHENE CARBOXYLIC ACID; AKOS BBB/202; AKOS B000001; AKOS AU36-M200; BUTTPARK 30\06-07; 3-Chlorobenzothiophene-2-carboxylic acid |
| Molecular Formula |
C9H5ClO2S |
| Molecular Weight |
212.6528 |
| InChI |
InChI=1/C9H5ClO2S/c10-7-5-3-1-2-4-6(5)13-8(7)9(11)12/h1-4H,(H,11,12) |
| Molecular Structure |
![21211-22-3 3-Chlorobenzo[b]-2-thiophenecarboxylic acid](https://images-a.chemnet.com/suppliers/chembase/163/163549_1.gif)
|
| Density |
1.546g/cm3 |
| Boiling point |
395.1°C at 760 mmHg |
| Refractive index |
1.719 |
| Flash point |
192.8°C |
| Vapour Pressur |
5.94E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
